PDB ligand accession: DLU
DrugBank: DB08930
PubChem:
ChEMBL:
InChI Key: RHWKPHLQXYSBKR-BMIGLBTASA-N
SMILES: CC1CCOC2N1C(=O)C3=C(C(=O)C(=CN3C2)C(=O)NCc4ccc(cc4F)F)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Pyridinecarboxylic acids and derivatives
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P42166_DLU | P42166 | Lamina-associated polypeptide 2, | n/a | |
| 2 | Q76353_DLU | Q76353 | Integrase | n/a | |
| 3 | P14350_DLU | P14350 | Pro-Pol polyprotein (Pr125Pol) | n/a | |
| 4 | P42167_DLU | P42167 | Lamina-associated polypeptide 2, | n/a | |
| 5 | F2WR39_DLU | F2WR39 | Integrase | n/a | |
| 6 | E1ANT8_DLU | E1ANT8 | Pol protein | n/a |