PDB ligand accession: DMA
DrugBank: DB01785
PubChem:
ChEMBL:
InChI Key: CBIDRCWHNCKSTO-UHFFFAOYSA-N
SMILES: CC(=CCOP(=O)(O)OP(=O)(O)O)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Isoprenoid phosphates
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q8NT37_DMA | Q8NT37 | Geranylgeranyl pyrophosphate synthase | n/a | |
2 | P07884_DMA | P07884 | tRNA dimethylallyltransferase (DMATase) | n/a | |
3 | O00481_DMA | O00481 | Butyrophilin subfamily 3 | n/a | |
4 | Q9A6I1_DMA | Q9A6I1 | Polyprenyl synthetase family | n/a | |
5 | A0A0F8R9A0_DMA | A0A0F8R9A0 | Dihydroorotate dehydrogenase (Undecaprenyl | n/a | |
6 | Q7KYR7_DMA | Q7KYR7 | Butyrophilin subfamily 2 | n/a | |
7 | P08836_DMA | P08836 | Farnesyl pyrophosphate synthase | n/a | |
8 | P14324_DMA | P14324 | Farnesyl pyrophosphate synthase | inhibitor | |
9 | Q57727_DMA | Q57727 | Digeranylgeranylglyceryl phosphate synthase | n/a | |
10 | Q02293_DMA | Q02293 | Protein farnesyltransferase subunit | n/a | |
11 | Q8TPS4_DMA | Q8TPS4 | Di-trans-poly-cis-decaprenylcistransferase | n/a | |
12 | Q8NNM1_DMA | Q8NNM1 | Geranylgeranyl pyrophosphate synthase | n/a | |
13 | Q03RR4_DMA | Q03RR4 | Farnesyl-diphosphate synthase (EC | n/a | |
14 | V5TDY7_DMA | V5TDY7 | Hapalindole dimethylallyltransferase (EC | n/a | |
15 | O25583_DMA | O25583 | Geranyltranstransferase (IspA) | n/a | |
16 | O28625_DMA | O28625 | Bacteriochlorophyll synthase, 33 | n/a | |
17 | P62623_DMA | P62623 | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | n/a | |
18 | Q4K5A6_DMA | Q4K5A6 | Geranyltranstransferase (EC 2.5.1.10) | n/a | |
19 | P61615_DMA | P61615 | Isopentenyl-diphosphate delta-isomerase (IPP | n/a | |
20 | Q04631_DMA | Q04631 | Protein farnesyltransferase/geranylgeranyltransferase type-1 | n/a | |
21 | A0A345DF50_DMA | A0A345DF50 | Butyrophylin 3 | n/a | |
22 | M4T4U9_DMA | M4T4U9 | Undecaprenyl diphosphate synthase | n/a | |
23 | A3F715_DMA | A3F715 | Flavin prenyltransferase PAD1, | n/a | |
24 | Q8WS26_DMA | Q8WS26 | Farnesyl diphosphate synthase | n/a | |
25 | A3MSH1_DMA | A3MSH1 | Polyprenyl synthetase | n/a | |
26 | Q86U81_DMA | Q86U81 | Isopentenyl-diphosphate Delta-isomerase 1 | n/a |