PDB ligand accession: DZF
DrugBank: n/a
PubChem: 445175;135460994;
ChEMBL: n/a
InChI Key: NFARHPAOOHOWAL-AWEZNQCLSA-N
SMILES: c1cc(ccc1C(=O)NC(CCC(=O)O)C(=O)O)NCc2cc3c(nc2)NC(=NC3=O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P0ABQ4_DZF | P0ABQ4 | Dihydrofolate reductase (EC | n/a | |
2 | P08179_DZF | P08179 | Phosphoribosylglycinamide formyltransferase (EC | n/a | |
3 | P00374_DZF | P00374 | Dihydrofolate reductase (EC | n/a |