PDB ligand accession: ECH
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: QXNWZXMBUKUYMD-QQGJMDNJSA-N
SMILES: CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(C(=O)CCC2(C)C)C)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P72986_ECH | P72986 | Photosystem I reaction | n/a | |
| 2 | P72717_ECH | P72717 | Cytochrome b6-f complex | n/a | |
| 3 | P37277_ECH | P37277 | Photosystem I reaction | n/a | |
| 4 | P74102_ECH | P74102 | Orange carotenoid-binding protein | n/a | |
| 5 | W8SUA3_ECH | W8SUA3 | Photosystem I P700 | n/a | |
| 6 | P74810_ECH | P74810 | Cytochrome b6-f complex | n/a | |
| 7 | P27589_ECH | P27589 | Cytochrome b6-f complex | n/a | |
| 8 | A0A1J1JHR9_ECH | A0A1J1JHR9 | Orange carotenoid-binding protein | n/a | |
| 9 | U5QHX0_ECH | U5QHX0 | OCP N-terminal domain-containing | n/a | |
| 10 | P58565_ECH | P58565 | Photosystem I P700 | n/a | |
| 11 | P74564_ECH | P74564 | Photosystem I reaction | n/a | |
| 12 | Q57038_ECH | Q57038 | Cytochrome b6 | n/a | |
| 13 | P29255_ECH | P29255 | Photosystem I P700 | n/a | |
| 14 | P29254_ECH | P29254 | Photosystem I P700 | n/a | |
| 15 | Q55330_ECH | Q55330 | Photosystem I reaction | n/a | |
| 16 | P74149_ECH | P74149 | Cytochrome b6-f complex | n/a | |
| 17 | W8SU98_ECH | W8SU98 | Photosystem I reaction | n/a |