PDB ligand accession: ERM
DrugBank: DB00696
PubChem:
ChEMBL:
InChI Key: XCGSFFUVFURLIX-VFGNJEKYSA-N
SMILES: CC1(C(=O)N2C(C(=O)N3CCCC3C2(O1)O)Cc4ccccc4)NC(=O)C5CN(C6Cc7c[nH]c8c7c(ccc8)C6=C5)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Alkaloids and derivatives
- Class: Ergoline and derivatives
- Subclass: Lysergic acids and derivatives
- Class: Ergoline and derivatives
- Superclass: Alkaloids and derivatives
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | P18825_ERM | P18825 | n/a | |
2 | P28222_ERM | P28222 | agonist | Ki(nM) = 2.1 |
3 | P08908_ERM | P08908 | agonist | |
4 | P35368_ERM | P35368 | partial agonist | |
5 | P30939_ERM | P30939 | agonist | Ki(nM) = 169.82 |
6 | P14416_ERM | P14416 | agonist | |
7 | P28221_ERM | P28221 | agonist | Ki(nM) = 0.8 |
8 | P08913_ERM | P08913 | partial agonist | |
9 | P41595_ERM | P41595 | n/a | Ki(nM) = 3.0 |
10 | P28223_ERM | P28223 | agonist | Ki(nM) = 0.64 |
11 | P25100_ERM | P25100 | partial agonist | |
12 | P28335_ERM | P28335 | agonist | Ki(nM) = 9.77 |
13 | P35348_ERM | P35348 | partial agonist |