PDB ligand accession: F43
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: XLFIRMYGVLUNOY-SXMZNAGASA-M
SMILES: CC12CC(=O)NC13CC4C(C(C5=[N]4[Ni+]67[N]3=C(C2CCC(=O)O)C=C8N6C(=C9C(=O)CCC1C9=[N]7C(C5)C1CC(=O)O)C(C8CC(=O)O)CCC(=O)O)(C)CC(=O)N)CCC(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: None
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P07955_F43 | P07955 | Methyl-coenzyme M reductase | n/a | |
2 | H1KXL6_F43 | H1KXL6 | Methyl-coenzyme M reductase | n/a | |
3 | H1KXL5_F43 | H1KXL5 | Methyl-coenzyme M reductase | n/a | |
4 | A0A1C7D1E5_F43 | A0A1C7D1E5 | Methyl-coenzyme M reductase | n/a | |
5 | P07964_F43 | P07964 | Methyl-coenzyme M reductase | n/a | |
6 | P58815_F43 | P58815 | Methyl-coenzyme M reductase | n/a | |
7 | Q8THH0_F43 | Q8THH0 | Methyl-coenzyme M reductase | n/a | |
8 | H7CHY2_F43 | H7CHY2 | coenzyme-B sulfoethylthiotransferase (EC | n/a | |
9 | A0A247D6X4_F43 | A0A247D6X4 | Methyl-coenzyme M reductase | n/a | |
10 | P07962_F43 | P07962 | Methyl-coenzyme M reductase | n/a | |
11 | Q49605_F43 | Q49605 | Methyl-coenzyme M reductase | n/a | |
12 | Q49604_F43 | Q49604 | Methyl-coenzyme M reductase | n/a | |
13 | A0A247D6X3_F43 | A0A247D6X3 | Methyl-coenzyme M reductase | n/a | |
14 | A0A1C7D1E2_F43 | A0A1C7D1E2 | Methyl-coenzyme M reductase | n/a | |
15 | A0A1C7D1E3_F43 | A0A1C7D1E3 | Methyl-coenzyme M reductase | n/a | |
16 | H1KXL9_F43 | H1KXL9 | Methyl-coenzyme M reductase | n/a | |
17 | Q49601_F43 | Q49601 | Methyl-coenzyme M reductase | n/a | |
18 | A0A8I3AZW6_F43 | A0A8I3AZW6 | Methyl-coenzyme M reductase | n/a | |
19 | A0A8I3AZW4_F43 | A0A8I3AZW4 | Methyl-coenzyme M reductase | n/a | |
20 | A0A8I3AZW5_F43 | A0A8I3AZW5 | Methyl-coenzyme M reductase | n/a | |
21 | Q8THH1_F43 | Q8THH1 | Methyl-coenzyme M reductase | n/a | |
22 | A0A1C7D1E4_F43 | A0A1C7D1E4 | Methyl-coenzyme M reductase | n/a | |
23 | P11562_F43 | P11562 | Methyl-coenzyme M reductase | n/a | |
24 | A0A247D6X5_F43 | A0A247D6X5 | Methyl-coenzyme M reductase | n/a | |
25 | H7CHY1_F43 | H7CHY1 | coenzyme-B sulfoethylthiotransferase (EC | n/a | |
26 | D9PXZ6_F43 | D9PXZ6 | Methyl-coenzyme M reductase | n/a | |
27 | Q8THG7_F43 | Q8THG7 | Methyl-coenzyme M reductase | n/a | |
28 | P11558_F43 | P11558 | Methyl-coenzyme M reductase | n/a | |
29 | P11560_F43 | P11560 | Methyl-coenzyme M reductase | n/a | |
30 | P58816_F43 | P58816 | Methyl-coenzyme M reductase | n/a |