PDB ligand accession: FPP
DrugBank: DB07780
PubChem:
ChEMBL:
InChI Key: VWFJDQUYCIWHTN-YFVJMOTDSA-N
SMILES: CC(=CCCC(=CCCC(=CCOP(=O)(O)OP(=O)(O)O)C)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Sesquiterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P14324_FPP | P14324 | Farnesyl pyrophosphate synthase | n/a | |
2 | P49356_FPP | P49356 | Protein farnesyltransferase subunit | n/a | |
3 | T2BPA1_FPP | T2BPA1 | Protein farnesyltransferase subunit | n/a | |
4 | O95749_FPP | O95749 | Geranylgeranyl pyrophosphate synthase | n/a | |
5 | Q8EBR3_FPP | Q8EBR3 | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | n/a | |
6 | Q02293_FPP | Q02293 | Protein farnesyltransferase subunit | n/a | |
7 | Q4WP27_FPP | Q4WP27 | Protein farnesyltransferase/geranylgeranyltransferase type-1 | n/a | |
8 | P60472_FPP | P60472 | Ditrans,polycis-undecaprenyl-diphosphate synthase ((2E,6E)-farnesyl-diphosphate | n/a | |
9 | Q5RKJ4_FPP | Q5RKJ4 | Protein farnesyltransferase/geranylgeranyltransferase type-1 | n/a | |
10 | Q08602_FPP | Q08602 | Geranylgeranyl transferase type-2 | n/a | |
11 | A0A2Y0TBT9_FPP | A0A2Y0TBT9 | deleted | n/a | |
12 | P53611_FPP | P53611 | Geranylgeranyl transferase type-2 | n/a | |
13 | Q12051_FPP | Q12051 | Geranylgeranyl pyrophosphate synthase | n/a | |
14 | Q40577_FPP | Q40577 | 5-epi-aristolochene synthase (TEAS) | n/a | |
15 | Q97SR4_FPP | Q97SR4 | Isoprenyl transferase (EC | n/a | |
16 | Q8DRB3_FPP | Q8DRB3 | Isoprenyl transferase (EC | n/a | |
17 | Q92696_FPP | Q92696 | Geranylgeranyl transferase type-2 | n/a | |
18 | P49354_FPP | P49354 | Protein farnesyltransferase/geranylgeranyltransferase type-1 | n/a | |
19 | P08836_FPP | P08836 | Farnesyl pyrophosphate synthase | n/a | |
20 | A0A2P2GK84_FPP | A0A2P2GK84 | Drimenyl diphosphate synthase | n/a | |
21 | J9VSJ6_FPP | J9VSJ6 | Protein farnesyltransferase/geranylgeranyltransferase type-1 | n/a | |
22 | Q04631_FPP | Q04631 | Protein farnesyltransferase/geranylgeranyltransferase type-1 | n/a | |
23 | Q08603_FPP | Q08603 | Geranylgeranyl transferase type-2 | n/a | |
24 | P0A924_FPP | P0A924 | Phosphatidylglycerophosphatase B (EC | n/a | |
25 | A0A5S9I252_FPP | A0A5S9I252 | Terpene cyclase 6 | n/a | |
26 | P60477_FPP | P60477 | Isoprenyl transferase (EC | n/a | |
27 | O53434_FPP | O53434 | (2Z,6E)-farnesyl diphosphate synthase | n/a | |
28 | Q8TPS4_FPP | Q8TPS4 | Di-trans-poly-cis-decaprenylcistransferase | n/a | |
29 | Q9UR08_FPP | Q9UR08 | Aristolochene synthase (AS) | n/a | |
30 | A0A0A0RCB5_FPP | A0A0A0RCB5 | Sesquisabinene B synthase | n/a | |
31 | P01116_FPP | P01116 | GTPase KRas (EC | n/a | |
32 | Q9FT89_FPP | Q9FT89 | Solanesyl diphosphate synthase | n/a | |
33 | Q4WPS9_FPP | Q4WPS9 | Protein farnesyltransferase subunit | n/a |