PDB ligand accession: FT6
DrugBank: n/a
PubChem: 688007;6921540;
ChEMBL: n/a
InChI Key: YMEXGEAJNZRQEH-VIFPVBQESA-N
SMILES: c1cc2c(cc1F)[nH]cc2CC(C(=O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indolyl carboxylic acids and derivatives
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q8PDA8_FT6 | Q8PDA8 | Tryptophan 2,3-dioxygenase (TDO) | n/a | |
2 | Q9S3V1_FT6 | Q9S3V1 | Flavin-dependent L-tryptophan oxidase | n/a |