PDB ligand accession: FUN
DrugBank: DB00695
PubChem: 3440;118985385;
ChEMBL:
InChI Key: ZZUFCTLCJUWOSV-UHFFFAOYSA-N
SMILES: c1cc(oc1)CNc2cc(c(cc2C(=O)O)S(=O)(=O)N)Cl
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzenesulfonamides
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q9NZ45_FUN | Q9NZ45 | CDGSH iron-sulfur domain-containing | n/a | Ki(nM) = 2285.0 IC50(nM) = 53460.0 Kd(nM) = 53000.0 |
2 | P00918_FUN | P00918 | Carbonic anhydrase 2 | inhibitor | Ki(nM) = 65.0 |
3 | Q9HC97_FUN | Q9HC97 | G-protein coupled receptor | agonist | Ki(nM) = 3270.0 EC50(nM) = 6200.0 |
4 | P05543_FUN | P05543 | Thyroxine-binding globulin (Serpin | n/a | |
5 | A4GRE3_FUN | A4GRE3 | Macrophage migration inhibitory | n/a |