PDB ligand accession: GBM
DrugBank: DB01016
PubChem:
ChEMBL:
InChI Key: ZNNLBTZKUZBEKO-UHFFFAOYSA-N
SMILES: COc1ccc(cc1C(=O)NCCc2ccc(cc2)S(=O)(=O)NC(=O)NC3CCCCC3)Cl
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzenesulfonamides
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | O95477_GBM | O95477 | Phospholipid-transporting ATPase ABCA1 | inhibitor | |
| 2 | P50416_GBM | P50416 | Carnitine O-palmitoyltransferase 1, | inhibitor | |
| 3 | Q8I5R7_GBM | Q8I5R7 | Proline--tRNA ligase (PfPRS) | n/a | |
| 4 | A0A1U7R319_GBM | A0A1U7R319 | ATP-binding cassette sub-family | n/a | |
| 5 | Q04828_GBM | Q04828 | Aldo-keto reductase family | n/a | |
| 6 | P42330_GBM | P42330 | Aldo-keto reductase family | n/a | |
| 7 | Q8TD43_GBM | Q8TD43 | Transient receptor potential | inhibitor | |
| 8 | P13569_GBM | P13569 | Cystic fibrosis transmembrane | antagonist | IC50(nM) = 15000.0 |
| 9 | O60706_GBM | O60706 | ATP-binding cassette sub-family | modulator | |
| 10 | O95342_GBM | O95342 | Bile salt export | inhibitor | Ki(nM) = 27500.0 IC50(nM) = 1500.0 |