PDB ligand accession: GDS
DrugBank: DB03310
PubChem: 65359;11215652;
ChEMBL:
InChI Key: YPZRWBKMTBYPTK-BJDJZHNGSA-N
SMILES: C(CC(=O)NC(CSSCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N)C(=O)NCC(=O)O)C(C(=O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | B8F653_GDS | B8F653 | Heme-binding protein A | n/a | |
2 | P28161_GDS | P28161 | Glutathione S-transferase Mu | activator | |
3 | A0A485ICL5_GDS | A0A485ICL5 | deleted | n/a | |
4 | P77526_GDS | P77526 | Disulfide-bond oxidoreductase YfcG | n/a | |
5 | P00390_GDS | P00390 | Glutathione reductase, mitochondrial | substrate | |
6 | Q8YY76_GDS | Q8YY76 | glutathione gamma-glutamylcysteinyltransferase (EC | n/a | |
7 | P09211_GDS | P09211 | Glutathione S-transferase P | activator | |
8 | I7A570_GDS | I7A570 | Glutathione transferase Ure2p1 | n/a | |
9 | A0A0R4I981_GDS | A0A0R4I981 | PcUre2p6 | n/a | |
10 | P78417_GDS | P78417 | Glutathione S-transferase omega-1 | n/a | |
11 | P10620_GDS | P10620 | Microsomal glutathione S-transferase | activator | |
12 | A5W1A6_GDS | A5W1A6 | Glutathione S-transferase, N-terminal | n/a | |
13 | Q8MU52_GDS | Q8MU52 | Glutathione S-transferase (PfGST) | n/a | |
14 | F4Y426_GDS | F4Y426 | CurJ (Polyketide synthase | n/a | |
15 | B0Y813_GDS | B0Y813 | glutathione transferase (EC | n/a | |
16 | A0A0R4I985_GDS | A0A0R4I985 | PcUre2p8 | n/a | |
17 | A0A0R4I980_GDS | A0A0R4I980 | PcUre2p4 | n/a | |
18 | M2L4D8_GDS | M2L4D8 | deleted | n/a | |
19 | A3CNR0_GDS | A3CNR0 | Conserved uncharacterized protein | n/a | |
20 | Q2G506_GDS | Q2G506 | ATM1-type heavy metal | n/a | |
21 | Q9LVM1_GDS | Q9LVM1 | ABC transporter B | n/a | |
22 | I7B368_GDS | I7B368 | Glutathione transferase Ure2p5 | n/a | |
23 | A8MJH2_GDS | A8MJH2 | Glutaredoxin | n/a | |
24 | Q06A71_GDS | Q06A71 | glutathione transferase (EC | n/a |