Ligand name: 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one
PDB ligand accession: GMJ
DrugBank: DB00502
PubChem: 3559
ChEMBL: CHEMBL54
InChI Key: LNEPOXFFQSENCJ-UHFFFAOYSA-N
SMILES: c1cc(ccc1C(=O)CCCN2CCC(CC2)(c3ccc(cc3)Cl)O)F

ClassyFire chemical classification:

List of proteins that are targets for GMJ

# DrugDomain Data UniProt Accession Drug Action Affinity data
1 P50406_GMJ P50406 n/a Ki(nM) = 1083.0
2 P08913_GMJ P08913 n/a Ki(nM) = 600.0
3 Q99705_GMJ Q99705 n/a
4 Q13224_GMJ Q13224 antagonist
5 P18825_GMJ P18825 n/a Ki(nM) = 550.0
6 P35462_GMJ P35462 inverse agonist Ki(nM) = 0.2
IC50(nM) = 0.06
7 P08908_GMJ P08908 n/a Ki(nM) = 1202.0
IC50(nM) = 1500.0
8 P21728_GMJ P21728 antagonist Ki(nM) = 6.17
9 Q99720_GMJ Q99720 n/a Ki(nM) = 0.2
IC50(nM) = 2.1
10 P35348_GMJ P35348 n/a Ki(nM) = 6.1
11 P28223_GMJ P28223 antagonist Ki(nM) = 20.0
IC50(nM) = 288.0
12 P14416_GMJ P14416 antagonist Ki(nM) = 0.12
IC50(nM) = 0.16
Kd(nM) = 0.489779
13 P34969_GMJ P34969 n/a Ki(nM) = 316.0
14 P28335_GMJ P28335 antagonist Ki(nM) = 35.71
IC50(nM) = 10000.0
15 P9WFK7_GMJ P9WFK7 n/a Ki(nM) = 390.0
IC50(nM) = 390.0
16 P35367_GMJ P35367 n/a Ki(nM) = 260.0
17 P18089_GMJ P18089 n/a Ki(nM) = 480.0
18 P20309_GMJ P20309 n/a Ki(nM) = 4670.0