PDB ligand accession: GNH
DrugBank: DB02623
PubChem: 444148;5288454;6602185;135480785;135612789;
ChEMBL: n/a
InChI Key: ZGPDMUBRWRJAQQ-UUOKFMHZSA-N
SMILES: c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(N)O)O)O)N=C(NC2=O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P0A7D4_GNH | P0A7D4 | Adenylosuccinate synthetase (AMPSase) | n/a | |
2 | Q9SN68_GNH | Q9SN68 | Ras-related protein RABF2b | n/a | |
3 | Q5M586_GNH | Q5M586 | Ferrous iron transport | n/a | |
4 | P60953_GNH | P60953 | Cell division control | n/a | |
5 | Q8GJ95_GNH | Q8GJ95 | Putative 6-deoxy-D-mannoheptose pathway | n/a | |
6 | P33650_GNH | P33650 | Fe(2+) transporter FeoB | n/a | |
7 | O00429_GNH | O00429 | Dynamin-1-like protein (EC | n/a | |
8 | Q9LT31_GNH | Q9LT31 | Vacuolar protein sorting-associated | n/a |