PDB ligand accession: GPP
DrugBank: DB02552
PubChem:
ChEMBL:
InChI Key: GVVPGTZRZFNKDS-JXMROGBWSA-N
SMILES: CC(=CCCC(=CCOP(=O)(O)OP(=O)(O)O)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Isoprenoid phosphates
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | O53434_GPP | O53434 | (2Z,6E)-farnesyl diphosphate synthase | n/a | |
2 | P36663_GPP | P36663 | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | n/a | |
3 | M1JS91_GPP | M1JS91 | Farnesyl pyrophosphate synthase | n/a | |
4 | A0A1J1JDI6_GPP | A0A1J1JDI6 | Putative prenyl transferase | n/a | |
5 | Q4R2T2_GPP | Q4R2T2 | Prenyltransferase | n/a | |
6 | M4I1C6_GPP | M4I1C6 | Geranyl diphosphate phosphohydrolase | n/a | |
7 | Q12051_GPP | Q12051 | Geranylgeranyl pyrophosphate synthase | n/a | |
8 | O95749_GPP | O95749 | Geranylgeranyl pyrophosphate synthase | n/a | |
9 | D3KYU3_GPP | D3KYU3 | Geranyl diphosphate 2-C-methyltransferase | n/a | |
10 | P60479_GPP | P60479 | Decaprenyl diphosphate synthase | n/a | |
11 | Q9HWY4_GPP | Q9HWY4 | Geranyltranstransferase | n/a | |
12 | A0A010_GPP | A0A010 | MoeN5 | n/a | |
13 | M4T4U9_GPP | M4T4U9 | Undecaprenyl diphosphate synthase | n/a | |
14 | P08836_GPP | P08836 | Farnesyl pyrophosphate synthase | n/a | |
15 | Q9F1Y5_GPP | Q9F1Y5 | Geranyl diphosphate 2-C-methyltransferase | n/a | |
16 | Q9PM68_GPP | Q9PM68 | Bifunctional enzyme IspD/IspF | n/a | |
17 | P62617_GPP | P62617 | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase | n/a | |
18 | P14324_GPP | P14324 | Farnesyl pyrophosphate synthase | inhibitor | |
19 | O28625_GPP | O28625 | Bacteriochlorophyll synthase, 33 | n/a | |
20 | Q9CA40_GPP | Q9CA40 | Nudix hydrolase 1 | n/a | |
21 | Q9SBR3_GPP | Q9SBR3 | Geranyl diphosphate synthase | n/a |