PDB ligand accession: GQK
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: JDPKNDJAIBLVBS-BZACYDOXSA-N
SMILES: CC(C(=O)NC(Cc1ccc(cc1)OC)C(=O)NC(Cc2ccccc2)C(C(C)(C)O)O)NC(=O)CN3CCOCC3
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P25451_GQK | P25451 | Proteasome subunit beta | n/a | |
2 | P25043_GQK | P25043 | Proteasome subunit beta | n/a | |
3 | P40306_GQK | P40306 | Proteasome subunit beta | n/a | |
4 | P23724_GQK | P23724 | Proteasome subunit beta | n/a | |
5 | P30656_GQK | P30656 | Proteasome subunit beta | n/a | |
6 | P38624_GQK | P38624 | Proteasome subunit beta | n/a | |
7 | Q99436_GQK | Q99436 | Proteasome subunit beta | n/a |