PDB ligand accession: GRG
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: OINNEUNVOZHBOX-QIRCYJPOSA-N
SMILES: CC(=CCCC(=CCCC(=CCCC(=CCOP(=O)(O)OP(=O)(O)O)C)C)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Diterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q12051_GRG | Q12051 | Geranylgeranyl pyrophosphate synthase | n/a | |
2 | A5K4U6_GRG | A5K4U6 | Farnesyl pyrophosphate synthase, | n/a | |
3 | O95749_GRG | O95749 | Geranylgeranyl pyrophosphate synthase | n/a | |
4 | G9MAN7_GRG | G9MAN7 | Bifunctional diterpene synthase, | n/a | |
5 | P53610_GRG | P53610 | Geranylgeranyl transferase type-1 | n/a | |
6 | Q4JA33_GRG | Q4JA33 | Digeranylgeranylglycerophospholipid reductase (DGGGPL | n/a | |
7 | P09467_GRG | P09467 | Fructose-1,6-bisphosphatase 1 (FBPase | n/a | |
8 | Q43133_GRG | Q43133 | Geranylgeranyl pyrophosphate synthase, | n/a | |
9 | Q08602_GRG | Q08602 | Geranylgeranyl transferase type-2 | n/a | |
10 | Q9Y765_GRG | Q9Y765 | Protein farnesyltransferase/geranylgeranyltransferase type-1 | n/a | |
11 | P53611_GRG | P53611 | Geranylgeranyl transferase type-2 | n/a | |
12 | Q7Z6K3_GRG | Q7Z6K3 | Protein prenyltransferase alpha | n/a | |
13 | Q08603_GRG | Q08603 | Geranylgeranyl transferase type-2 | n/a | |
14 | Q04631_GRG | Q04631 | Protein farnesyltransferase/geranylgeranyltransferase type-1 | n/a | |
15 | F8JK18_GRG | F8JK18 | Cattleyene synthase (CyS) | n/a | |
16 | Q02293_GRG | Q02293 | Protein farnesyltransferase subunit | n/a |