PDB ligand accession: HBI
DrugBank: DB04400
PubChem: 119055;5288515;135398687;
ChEMBL: n/a
InChI Key: FEMXZDUTFRTWPE-DZSWIPIPSA-N
SMILES: CC(C(C1=NC2=C(NC1)N=C(NC2=O)N)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P22288_HBI | P22288 | GTP cyclohydrolase 1 | n/a | |
2 | P30047_HBI | P30047 | GTP cyclohydrolase 1 | n/a | |
3 | Q01782_HBI | Q01782 | Pteridine reductase 1 | n/a | |
4 | P29476_HBI | P29476 | Nitric oxide synthase | n/a | |
5 | P00439_HBI | P00439 | Phenylalanine-4-hydroxylase (PAH) (EC | n/a | |
6 | P61457_HBI | P61457 | Pterin-4-alpha-carbinolamine dehydratase (PHS) | n/a | |
7 | P61459_HBI | P61459 | Pterin-4-alpha-carbinolamine dehydratase (PHS) | n/a | |
8 | P07101_HBI | P07101 | Tyrosine 3-monooxygenase (EC | inhibitor | |
9 | P29477_HBI | P29477 | Nitric oxide synthase, | n/a | |
10 | O34453_HBI | O34453 | Nitric oxide synthase | n/a | |
11 | P30793_HBI | P30793 | GTP cyclohydrolase 1 | n/a | |
12 | Q93EY3_HBI | Q93EY3 | UDP-glucose:tetrahydrobiopterin glucosyltransferase | n/a | |
13 | P30967_HBI | P30967 | Phenylalanine-4-hydroxylase (PAH) (EC | n/a | |
14 | Q9U1F8_HBI | Q9U1F8 | Pteridine reductase 1 | n/a | |
15 | P04177_HBI | P04177 | Tyrosine 3-monooxygenase (EC | n/a | |
16 | P70552_HBI | P70552 | GTP cyclohydrolase 1 | n/a | |
17 | P17752_HBI | P17752 | Tryptophan 5-hydroxylase 1 | n/a | |
18 | P00378_HBI | P00378 | Dihydrofolate reductase (EC | n/a | |
19 | P35228_HBI | P35228 | Nitric oxide synthase, | inhibitor | |
20 | Q54XS1_HBI | Q54XS1 | Phenylalanine-4-hydroxylase (PAH) (EC | n/a |