PDB ligand accession: HCQ
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: MOEIXULQWWCKOY-UHFFFAOYSA-N
SMILES: [B-](c1cc2cc(ccc2s1)CN)(O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Benzothiophenes
- Subclass: 1-benzothiophenes
- Class: Benzothiophenes
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | C7C422_HCQ | C7C422 | Metallo-beta-lactamase type 2 | n/a |