PDB ligand accession: HH2
DrugBank: DB04047
PubChem: 151434;5288551;135440058;
ChEMBL: n/a
InChI Key: AMDUVUKDRBIVAH-UHFFFAOYSA-N
SMILES: c1c(nc2c(n1)N=C(NC2=O)N)COP(=O)(O)OP(=O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0A1K9YMY7_HH2 | A0A1K9YMY7 | deleted | n/a | |
2 | Q81VW8_HH2 | Q81VW8 | Dihydropteroate synthase (DHPS) | n/a | |
3 | Q7CKJ1_HH2 | Q7CKJ1 | Dihydropteroate synthase (DHPS) | n/a | |
4 | O05701_HH2 | O05701 | Dihydropteroate synthase (DHPS) | n/a | |
5 | Q5SLV2_HH2 | Q5SLV2 | Dihydropteroate synthase (DHPS) | n/a | |
6 | P26281_HH2 | P26281 | 2-amino-4-hydroxy-6-hydroxymethyldihydropteridine pyrophosphokinase (EC | n/a |