PDB ligand accession: ID8
DrugBank: DB00784
PubChem:
ChEMBL:
InChI Key: HYYBABOKPJLUIN-UHFFFAOYSA-N
SMILES: Cc1cccc(c1C)Nc2ccccc2C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzoic acids and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P23219_ID8 | P23219 | Prostaglandin G/H synthase | inhibitor | Ki(nM) = 1940.0 IC50(nM) = 25000.0 |
2 | P42330_ID8 | P42330 | Aldo-keto reductase family | n/a | Ki(nM) = 300.0 IC50(nM) = 560.0 |
3 | P52895_ID8 | P52895 | Aldo-keto reductase family | n/a | Ki(nM) = 220.0 IC50(nM) = 6970.0 |
4 | P35354_ID8 | P35354 | Prostaglandin G/H synthase | inhibitor | Ki(nM) = 160.0 IC50(nM) = 2900.0 |
5 | P24627_ID8 | P24627 | Lactotransferrin (Lactoferrin) (EC | n/a | |
6 | P05543_ID8 | P05543 | Thyroxine-binding globulin (Serpin | n/a |