PDB ligand accession: ITR
DrugBank: DB02988
PubChem: n/a
ChEMBL: n/a
InChI Key: LKYWXXAVLLVJAS-XFXZXTDPSA-N
SMILES: c1ccc2c(c1)c(c[nH]2)CC(=N)C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indolyl carboxylic acids and derivatives
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P14920_ITR | P14920 | D-amino-acid oxidase (DAAO) | n/a | |
2 | P00371_ITR | P00371 | D-amino-acid oxidase (DAAO) | n/a |