PDB ligand accession: IYR
DrugBank: DB01758
PubChem: 439744;6918986;
ChEMBL:
InChI Key: UQTZMGFTRHFAAM-ZETCQYMHSA-N
SMILES: c1cc(c(cc1CC(C(=O)O)N)I)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | Q6PHW0_IYR | Q6PHW0 | n/a | Kd(nM) = 90.0 |
2 | B9K712_IYR | B9K712 | n/a | |
3 | P00951_IYR | P00951 | n/a | |
4 | F4KU78_IYR | F4KU78 | n/a | Kd(nM) = 8200.0 |
5 | Q9DCX8_IYR | Q9DCX8 | n/a | |
6 | Q57834_IYR | Q57834 | n/a |