Ligand name: 2-[(2,6-dichloro-3-methyl-phenyl)amino]benzoic acid
PDB ligand accession: JMS
DrugBank: DB00939
PubChem: 4037
ChEMBL: CHEMBL509
InChI Key: SBDNJUWAMKYJOX-UHFFFAOYSA-N
SMILES: Cc1ccc(c(c1Cl)Nc2ccccc2C(=O)O)Cl

ClassyFire chemical classification:

List of proteins that are targets for JMS

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 Q04828_JMS Q04828 Aldo-keto reductase family n/a IC50(nM) = 740.0
2 P09917_JMS P09917 Polyunsaturated fatty acid inhibitor
3 P24627_JMS P24627 Lactotransferrin (Lactoferrin) (EC n/a
4 O43525_JMS O43525 Potassium voltage-gated channel other
5 P35354_JMS P35354 Prostaglandin G/H synthase inhibitor Ki(nM) = 200.0
IC50(nM) = 40.0
6 P23219_JMS P23219 Prostaglandin G/H synthase inhibitor Ki(nM) = 220.0
IC50(nM) = 220.0
7 O43526_JMS O43526 Potassium voltage-gated channel other
8 P42330_JMS P42330 Aldo-keto reductase family n/a IC50(nM) = 512.0
9 Q9C0B1_JMS Q9C0B1 Alpha-ketoglutarate-dependent dioxygenase FTO n/a IC50(nM) = 7940.0