PDB ligand accession: K0G
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: WBKYYDBHEGTTON-UHFFFAOYSA-N
SMILES: c1ccc(cc1)NC(=O)Nc2cccnc2
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: N-phenylureas
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P0DTD1_K0G | P0DTD1 | Replicase polyprotein 1ab | n/a | |
2 | Q7LBC6_K0G | Q7LBC6 | Lysine-specific demethylase 3B | n/a | |
3 | Q92835_K0G | Q92835 | Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase | n/a | |
4 | B2RID1_K0G | B2RID1 | Asp/Glu-specific dipeptidyl-peptidase (EC | n/a | |
5 | O15178_K0G | O15178 | T-box transcription factor | n/a | |
6 | Q6B856_K0G | Q6B856 | Tubulin beta-2B chain | n/a | |
7 | Q9UKK9_K0G | Q9UKK9 | ADP-sugar pyrophosphatase (EC | n/a | |
8 | P15379_K0G | P15379 | CD44 antigen (Extracellular | n/a | |
9 | P01584_K0G | P01584 | Interleukin-1 beta (IL-1 | n/a | |
10 | P81947_K0G | P81947 | Tubulin alpha-1B chain | n/a |