PDB ligand accession: K36
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: BSPZFJDYQHDZNR-HTCLRFROSA-N
SMILES: CC(C)CC(C(=O)NC(CC1CCNC1=O)C(O)S(=O)(=O)O)NC(=O)OCc2ccccc2
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P0DTD1_K36 | P0DTD1 | Replicase polyprotein 1ab | n/a | |
2 | Q83883_K36 | Q83883 | Genome polyprotein [Cleaved | n/a | |
3 | A0A1L2E0X0_K36 | A0A1L2E0X0 | Orf1a protein | n/a | |
4 | P03300_K36 | P03300 | Genome polyprotein [Cleaved | n/a | |
5 | P0DTC1_K36 | P0DTC1 | Replicase polyprotein 1a | n/a | |
6 | P0C6U8_K36 | P0C6U8 | Replicase polyprotein 1a | n/a | |
7 | K4L9I6_K36 | K4L9I6 | ORF1ab polyprotein | n/a | |
8 | P0C6V2_K36 | P0C6V2 | Replicase polyprotein 1a | n/a | |
9 | A0A7U3EDN3_K36 | A0A7U3EDN3 | ORF1a polyprotein | n/a | |
10 | B2BW31_K36 | B2BW31 | ORF1ab polyprotein | n/a | |
11 | D2WXL6_K36 | D2WXL6 | ORF1a polyprotein | n/a |