PDB ligand accession: KMP
DrugBank: DB01852
PubChem:
ChEMBL:
InChI Key: IYRMWMYZSQPJKC-UHFFFAOYSA-N
SMILES: c1cc(ccc1C2=C(C(=O)c3c(cc(cc3O2)O)O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Phenylpropanoids and polyketides
- Class: Flavonoids
- Subclass: Flavones
- Class: Flavonoids
- Superclass: Phenylpropanoids and polyketides
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | B5MGN9_KMP | B5MGN9 | Glycosyltransferase (EC 2.4.1.-) | n/a | |
2 | O93874_KMP | O93874 | 17beta-hydroxysteroid dehydrogenase | n/a | |
3 | A4F1R4_KMP | A4F1R4 | Glycosyltransferase (EC 2.4.1.-) | n/a | |
4 | P53355_KMP | P53355 | Death-associated protein kinase | n/a | IC50(nM) = 10000.0 |
5 | Q8NFU5_KMP | Q8NFU5 | Inositol polyphosphate multikinase | n/a | IC50(nM) = 4400.0 |
6 | P02766_KMP | P02766 | Transthyretin (ATTR) (Prealbumin) | n/a | |
7 | Q7SIC2_KMP | Q7SIC2 | Quercetin 2,3-dioxygenase (EC | n/a | |
8 | Q6NUS8_KMP | Q6NUS8 | UDP-glucuronosyltransferase 3A1 (UDPGT | n/a | |
9 | O22304_KMP | O22304 | Anthocyanidin 3-O-glucosyltransferase UFGT | n/a |