PDB ligand accession: L96
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: YBEJGNSQZJLYDL-UHFFFAOYSA-N
SMILES: Cc1c(c(n[nH]1)C)c2c3cc(ccc3n(c2c4cccc(c4)OC(C)C)CCC(=O)O)C5CC5
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indoles
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P15090_L96 | P15090 | Fatty acid-binding protein, | n/a |