PDB ligand accession: LNL
DrugBank: DB00132
PubChem:
ChEMBL:
InChI Key: DTOSIQBPPRVQHS-PDBXOOCHSA-N
SMILES: CCC=CCC=CCC=CCCCCCCCC(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Fatty Acyls
- Subclass: Lineolic acids and derivatives
- Class: Fatty Acyls
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P05413_LNL | P05413 | Fatty acid-binding protein, | n/a | |
2 | R4ZGX1_LNL | R4ZGX1 | Photosystem II CP47 | n/a | |
3 | P65306_LNL | P65306 | Putative phthiocerol dimycocerosate | n/a | |
4 | Q96RI1_LNL | Q96RI1 | Bile acid receptor | agonist | |
5 | P32418_LNL | P32418 | Sodium/calcium exchanger 1 | n/a | |
6 | Q07869_LNL | Q07869 | Peroxisome proliferator-activated receptor | n/a | IC50(nM) = 1200.0 Kd(nM) = 7.9 |
7 | P37231_LNL | P37231 | Peroxisome proliferator-activated receptor | n/a | IC50(nM) = 6000.0 Kd(nM) = 2000.0 |
8 | O60427_LNL | O60427 | Acyl-CoA (8-3)-desaturase (EC | ligand | |
9 | R4ZGS4_LNL | R4ZGS4 | Photosystem II reaction | n/a | |
10 | Q03181_LNL | Q03181 | Peroxisome proliferator-activated receptor | n/a | IC50(nM) = 16000.0 |
11 | R4ZGU2_LNL | R4ZGU2 | Photosystem II reaction | n/a | |
12 | Q9NXB9_LNL | Q9NXB9 | Very long chain | substrate | |
13 | Q8NER1_LNL | Q8NER1 | Transient receptor potential | inhibitor | |
14 | P50155_LNL | P50155 | Photosystem II protein | n/a | |
15 | Q05769_LNL | Q05769 | Prostaglandin G/H synthase | n/a | |
16 | P19793_LNL | P19793 | Retinoic acid receptor | n/a | |
17 | P19656_LNL | P19656 | Non-specific lipid-transfer protein | n/a | |
18 | Q9NYP7_LNL | Q9NYP7 | Very long chain | substrate | |
19 | R4ZGZ0_LNL | R4ZGZ0 | Photosystem II CP43 | n/a | |
20 | O95864_LNL | O95864 | Acyl-CoA 6-desaturase (EC | ligand | |
21 | R4ZGX6_LNL | R4ZGX6 | Photosystem II D2 | n/a |