Ligand name: {2-[(2-chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid
PDB ligand accession: LUR
DrugBank: DB01283
PubChem: 151166
ChEMBL: CHEMBL404108
InChI Key: KHPKQFYUPIUARC-UHFFFAOYSA-N
SMILES: Cc1ccc(c(c1)CC(=O)O)Nc2c(cccc2Cl)F

ClassyFire chemical classification:

List of proteins that are targets for LUR

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 Q05769_LUR Q05769 Prostaglandin G/H synthase n/a IC50(nM) = 40.0
2 P35354_LUR P35354 Prostaglandin G/H synthase inhibitor Ki(nM) = 320.0
IC50(nM) = 7.0
3 P23219_LUR P23219 Prostaglandin G/H synthase inhibitor IC50(nM) = 7.0
4 P02766_LUR P02766 Transthyretin (ATTR) (Prealbumin) n/a