PDB ligand accession: LVV
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: PBEMXBVPRZGFNM-UHFFFAOYSA-N
SMILES: Cc1ccc(cc1)CN2CCS(=O)(=O)CC2
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Phenylmethylamines
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P63043_LVV | P63043 | Stathmin-4 (Stathmin-like protein | n/a | |
| 2 | Q6B856_LVV | Q6B856 | Tubulin beta-2B chain | n/a | |
| 3 | P22188_LVV | P22188 | UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase (EC | n/a | |
| 4 | P81947_LVV | P81947 | Tubulin alpha-1B chain | n/a | |
| 5 | Q8WS26_LVV | Q8WS26 | Farnesyl diphosphate synthase | n/a |