PDB ligand accession: M77
DrugBank: DB08162
PubChem:
ChEMBL:
InChI Key: NGOGFTYYXHNFQH-UHFFFAOYSA-N
SMILES: c1cc2cnccc2c(c1)S(=O)(=O)N3CCCNCC3
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Isoquinolines and derivatives
- Subclass: None
- Class: Isoquinolines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | O75116_M77 | O75116 | Rho-associated protein kinase | n/a | Ki(nM) = 330.0 IC50(nM) = 71.0 Kd(nM) = 45.0 |
2 | Q13464_M77 | Q13464 | Rho-associated protein kinase | inhibitor | Ki(nM) = 100.0 IC50(nM) = 180.0 Kd(nM) = 50.0 |
3 | P00517_M77 | P00517 | cAMP-dependent protein kinase | n/a | IC50(nM) = 541.0 |
4 | P25321_M77 | P25321 | cAMP-dependent protein kinase | n/a | |
5 | O96013_M77 | O96013 | Serine/threonine-protein kinase PAK | n/a | |
6 | P17612_M77 | P17612 | cAMP-dependent protein kinase | n/a | IC50(nM) = 853.0 |
7 | Q28021_M77 | Q28021 | Rho-associated protein kinase | n/a | IC50(nM) = 485.0 |
8 | Q9Y5S2_M77 | Q9Y5S2 | Serine/threonine-protein kinase MRCK | n/a |