Ligand name: N-{(1S)-1-{[4-(3-AMINOPROPYL)PIPERAZIN-1-YL]CARBONYL}-4-[(DIAMINOMETHYLENE)AMINO]BUTYL}-3-(TRIFLUOROMETHYL)BENZENESULFONAMIDE
PDB ligand accession: MIU
DrugBank: n/a
PubChem: 6852123
ChEMBL: CHEMBL387841
InChI Key: KGJKWHCPJPBEJP-KRWDZBQOSA-N
SMILES: c1cc(cc(c1)S(=O)(=O)NC(CCCN=C(N)N)C(=O)N2CCN(CC2)CCCN)C(F)(F)F

ClassyFire chemical classification:

List of proteins that are targets for MIU

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P00734_MIU P00734 Prothrombin (EC 3.4.21.5) n/a