PDB ligand accession: MIY
DrugBank: DB01017
PubChem: n/a
ChEMBL:
InChI Key: DYKFCLLONBREIL-KVUCHLLUSA-N
SMILES: CN(C)c1ccc(c2c1CC3CC4C(C(=C(C(=O)C4(C(=C3C2=O)O)O)C(=O)N)O)N(C)C)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Phenylpropanoids and polyketides
- Class: Tetracyclines
- Subclass: None
- Class: Tetracyclines
- Superclass: Phenylpropanoids and polyketides
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | P01584_MIY | P01584 | modulator | |
2 | P09917_MIY | P09917 | inhibitor | |
3 | P42574_MIY | P42574 | negative modulator | |
4 | P15445_MIY | P15445 | n/a | |
5 | P15692_MIY | P15692 | inhibitor | |
6 | P99999_MIY | P99999 | negative modulator | |
7 | P14780_MIY | P14780 | inhibitor | IC50(nM) = 180000.0 |
8 | Q93L51_MIY | Q93L51 | n/a | |
9 | P04483_MIY | P04483 | n/a | |
10 | B0VCI2_MIY | B0VCI2 | n/a | |
11 | P0ACT4_MIY | P0ACT4 | n/a | |
12 | P31224_MIY | P31224 | n/a | |
13 | P29466_MIY | P29466 | negative modulator | |
14 | P35228_MIY | P35228 | inhibitor |