PDB ligand accession: MMK
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: RTKGUAPXWDCFNW-BQYQJAHWSA-N
SMILES: CCN(C=CN(C)C)C(=O)CNCc1cc(ccn1)C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q9UGL1_MMK | Q9UGL1 | Lysine-specific demethylase 5B | n/a | |
2 | O14607_MMK | O14607 | Histone demethylase UTY | n/a | |
3 | Q9H3R0_MMK | Q9H3R0 | Lysine-specific demethylase 4C | n/a | |
4 | P41229_MMK | P41229 | Lysine-specific demethylase 5C | n/a | |
5 | O75164_MMK | O75164 | Lysine-specific demethylase 4A | n/a | |
6 | P29375_MMK | P29375 | Lysine-specific demethylase 5A | n/a |