PDB ligand accession: MNB
DrugBank: DB02763
PubChem:
ChEMBL: n/a
InChI Key: GANZODCWZFAEGN-UHFFFAOYSA-N
SMILES: c1cc(c(cc1S)C(=O)O)[N+](=O)[O-]
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Benzoic acids and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | O15247_MNB | O15247 | Chloride intracellular channel | n/a | |
| 2 | Q8YY42_MNB | Q8YY42 | Alr1010 protein (CcbP) | n/a | |
| 3 | E3Y2F5_MNB | E3Y2F5 | deleted | n/a | |
| 4 | P29460_MNB | P29460 | Interleukin-12 subunit beta | n/a | |
| 5 | I6Y9J2_MNB | I6Y9J2 | L,D-transpeptidase 2 (LDT | n/a | |
| 6 | P0A006_MNB | P0A006 | Arsenate reductase (EC | n/a | |
| 7 | Q79JB5_MNB | Q79JB5 | Periplasmic protein (Polyisoprenoid-binding | n/a | |
| 8 | Q0PB90_MNB | Q0PB90 | Periplasmic protein | n/a | |
| 9 | P07174_MNB | P07174 | Tumor necrosis factor | n/a |