Ligand name: 4-[(4-METHYLPIPERAZIN-1-YL)METHYL]-N-{3-[(4-PYRIDIN-3-YLPYRIMIDIN-2-YL)AMINO]PHENYL}BENZAMIDE
PDB ligand accession: MPZ
DrugBank: DB04739
PubChem: 4369496
ChEMBL: CHEMBL56904
InChI Key: JHMBUEWQJDGKGS-UHFFFAOYSA-N
SMILES: CN1CCN(CC1)Cc2ccc(cc2)C(=O)Nc3cccc(c3)Nc4nccc(n4)c5cccnc5

ClassyFire chemical classification:

List of proteins that are targets for MPZ

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P12931_MPZ P12931 Proto-oncogene tyrosine-protein kinase n/a IC50(nM) = 7800.0