PDB ligand accession: MQ9
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: WCRXHNIUHQUASO-ABFXHILCSA-N
SMILES: CC1=C(C(=O)c2ccccc2C1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Quinone and hydroquinone lipids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0A2S6NEP5_MQ9 | A0A2S6NEP5 | Reaction center protein | n/a | |
2 | P04123_MQ9 | P04123 | Light-harvesting protein B-1015 | n/a | |
3 | P06010_MQ9 | P06010 | Reaction center protein | n/a | |
4 | A0QU29_MQ9 | A0QU29 | NADH-quinone oxidoreductase subunit | n/a | |
5 | B8Y5U7_MQ9 | B8Y5U7 | Reaction center protein | n/a | |
6 | P06009_MQ9 | P06009 | Reaction center protein | n/a | |
7 | B8Y5U6_MQ9 | B8Y5U6 | Reaction center protein | n/a | |
8 | A0QU33_MQ9 | A0QU33 | NADH-quinone oxidoreductase subunit | n/a | |
9 | A0QT09_MQ9 | A0QT09 | Succinate dehydrogenase hydrophobic | n/a | |
10 | A0A2S6NEG7_MQ9 | A0A2S6NEG7 | Reaction center protein | n/a | |
11 | P06008_MQ9 | P06008 | Reaction center protein | n/a | |
12 | L7N662_MQ9 | L7N662 | Probable integral membrane | n/a |