PDB ligand accession: MSS
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: BDXDYZBRBRKVRM-MRZGRPIRSA-L
SMILES: C(C1C2=C(C3C(O1)NC4=C(N3)C(=O)NC(=N4)N)S[Mo](=O)S2)OP(=O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q92M24_MSS | Q92M24 | Sulfite oxidase (EC | n/a | |
2 | Q9LA16_MSS | Q9LA16 | Sulfite:cytochrome c oxidoreductase | n/a |