PDB ligand accession: MTN
DrugBank: DB08217
PubChem:
ChEMBL: n/a
InChI Key: MXZPGYFBZHBAQM-UHFFFAOYSA-N
SMILES: CC1(C=C(C(N1[O])(C)C)CSS(=O)(=O)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyrrolines
- Subclass: None
- Class: Pyrrolines
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P06129_MTN | P06129 | Vitamin B12 transporter | n/a | |
| 2 | P01375_MTN | P01375 | Tumor necrosis factor | n/a | |
| 3 | O67854_MTN | O67854 | Na(+):neurotransmitter symporter (Snf | n/a | |
| 4 | O06796_MTN | O06796 | Possible exported protein | n/a | |
| 5 | P11076_MTN | P11076 | ADP-ribosylation factor 1 | n/a | |
| 6 | Q57254_MTN | Q57254 | Afimbrial adhesin AFA-III | n/a | |
| 7 | D9IEF7_MTN | D9IEF7 | Endolysin (EC 3.2.1.17) | n/a | |
| 8 | Q1PBJ5_MTN | Q1PBJ5 | Apical membrane antigen-1 | n/a | |
| 9 | P07260_MTN | P07260 | Eukaryotic translation initiation | n/a | |
| 10 | P19909_MTN | P19909 | Immunoglobulin G-binding protein | n/a | |
| 11 | Q04773_MTN | Q04773 | Uncharacterized protein YMR074C | n/a | |
| 12 | P0A334_MTN | P0A334 | pH-gated potassium channel | n/a | |
| 13 | P06731_MTN | P06731 | Cell adhesion molecule | n/a | |
| 14 | P35530_MTN | P35530 | Surface presentation of | n/a | |
| 15 | P0CG48_MTN | P0CG48 | Polyubiquitin-C [Cleaved into: | n/a | |
| 16 | P07024_MTN | P07024 | Protein UshA [Includes: | n/a | |
| 17 | P06730_MTN | P06730 | Eukaryotic translation initiation | n/a | |
| 18 | P00183_MTN | P00183 | Camphor 5-monooxygenase (EC | n/a | |
| 19 | Q8VL32_MTN | Q8VL32 | CylR2 (Putative transcription | n/a | |
| 20 | P00720_MTN | P00720 | Endolysin (EC 3.2.1.17) | n/a | |
| 21 | Q9X4B7_MTN | Q9X4B7 | Putative outer membrane | n/a |