PDB ligand accession: NFL
DrugBank: DB04552
PubChem:
ChEMBL:
InChI Key: JZFPYUNJRRFVQU-UHFFFAOYSA-N
SMILES: c1cc(cc(c1)Nc2c(cccn2)C(=O)O)C(F)(F)F
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Trifluoromethylbenzenes
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P60045_NFL | P60045 | Acidic phospholipase A2 | n/a | |
2 | P35354_NFL | P35354 | Prostaglandin G/H synthase | inhibitor | Ki(nM) = 5400.0 |
3 | Q9HBL8_NFL | Q9HBL8 | NmrA-like family domain-containing | n/a | |
4 | O60656_NFL | O60656 | UDP-glucuronosyltransferase 1A9 (UGT1A9) | n/a | |
5 | P02730_NFL | P02730 | Band 3 anion | n/a | |
6 | P47712_NFL | P47712 | Cytosolic phospholipase A2 | n/a | |
7 | P23219_NFL | P23219 | Prostaglandin G/H synthase | n/a | Ki(nM) = 10000.0 |
8 | P04054_NFL | P04054 | Phospholipase A2 (EC | inhibitor |