PDB ligand accession: NG0
DrugBank: DB06274
PubChem: 5488548;51397022;
ChEMBL:
InChI Key: UPNUIXSCZBYVBB-JVFUWBCBSA-N
SMILES: CC1CN(CCC1(C)c2cccc(c2)O)CC(Cc3ccccc3)C(=O)NCC(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Peptidomimetics
- Subclass: Hybrid peptides
- Class: Peptidomimetics
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P41143_NG0 | P41143 | Delta-type opioid receptor | antagonist | Ki(nM) = 5.0 |
2 | P41145_NG0 | P41145 | Kappa-type opioid receptor | antagonist | |
3 | P42866_NG0 | P42866 | Mu-type opioid receptor | n/a | |
4 | P35372_NG0 | P35372 | Mu-type opioid receptor | antagonist | Ki(nM) = 0.316228 IC50(nM) = 3.0 |