PDB ligand accession: NOV
DrugBank: DB01051
PubChem:
ChEMBL:
InChI Key: YJQPYGGHQPGBLI-KGSXXDOSSA-N
SMILES: Cc1c(ccc2c1OC(=O)C(=C2O)NC(=O)c3ccc(c(c3)CC=C(C)C)O)OC4C(C(C(C(O4)(C)C)OC)OC(=O)N)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Phenylpropanoids and polyketides
- Class: Coumarins and derivatives
- Subclass: Coumarin glycosides
- Class: Coumarins and derivatives
- Superclass: Phenylpropanoids and polyketides
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | Q9H492_NOV | Q9H492 | n/a | Ki(nM) = 8800.0 IC50(nM) = 42900.0 Kd(nM) = 7500.0 |
2 | Q9I7C2_NOV | Q9I7C2 | n/a | |
3 | A0A009KIJ4_NOV | A0A009KIJ4 | n/a | |
4 | P0A0K8_NOV | P0A0K8 | inhibitor | IC50(nM) = 30.0 |
5 | Q9LCX5_NOV | Q9LCX5 | n/a | |
6 | P0A9V1_NOV | P0A9V1 | n/a | |
7 | A0A0H3CR83_NOV | A0A0H3CR83 | n/a | |
8 | A0A117ILT2_NOV | A0A117ILT2 | n/a | |
9 | X5EN43_NOV | X5EN43 | n/a | |
10 | P20083_NOV | P20083 | n/a | |
11 | P0C559_NOV | P0C559 | n/a | IC50(nM) = 46.0 |
12 | P06982_NOV | P06982 | n/a | |
13 | Q5GYJ8_NOV | Q5GYJ8 | n/a |