PDB ligand accession: OBV
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: IWKGTOOPBQHBLV-XOLYYWOLSA-L
SMILES: Cc1c2cc3[n+]4c(cc5n6c(cc7[n+]8c(cc(c1CCC(=O)O)n2[Fe]648)C(=C7C)CCC(=O)O)C(C5CCC(=O)O)(C)CC(=O)O)C(C3CCC(=O)O)(C)CC(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Metallotetrapyrroles
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | B8J3A4_OBV | B8J3A4 | Siroheme decarboxylase beta | n/a | |
2 | B8J364_OBV | B8J364 | Siroheme decarboxylase alpha | n/a |