PDB ligand accession: P1T
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: BXUDKFHCAMQSRX-UHFFFAOYSA-N
SMILES: Cc1c(c(c(cn1)COP(=O)(O)O)CNC(=C)C(=O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Pyridoxamines
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0A125YSJ9_P1T | A0A125YSJ9 | Cystathionine beta-synthase (EC | n/a | |
2 | A6QDA0_P1T | A6QDA0 | N-(2-amino-2-carboxyethyl)-L-glutamate synthase (ACEGA | n/a | |
3 | Q01594_P1T | Q01594 | Alliin lyase 1 | n/a | |
4 | P9WFX9_P1T | P9WFX9 | Tryptophan synthase beta | n/a | |
5 | P32582_P1T | P32582 | Cystathionine beta-synthase (EC | n/a | |
6 | P32929_P1T | P32929 | Cystathionine gamma-lyase (CGL) | n/a | |
7 | Q9VRD9_P1T | Q9VRD9 | Cystathionine beta-synthase (EC | n/a | |
8 | P0A2K1_P1T | P0A2K1 | Tryptophan synthase beta | n/a |