PDB ligand accession: P34
DrugBank: DB08348
PubChem: 4858;5289097;
ChEMBL:
InChI Key: UYJZZVDLGDDTCL-UHFFFAOYSA-N
SMILES: CN(C)CC(=O)Nc1ccc2c(c1)-c3ccccc3C(=O)N2
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Quinolines and derivatives
- Subclass: Benzoquinolines
- Class: Quinolines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | P11439_P34 | P11439 | n/a | |
2 | P09874_P34 | P09874 | inhibitor | IC50(nM) = 9.1 Kd(nM) = 110.0 EC50(nM) = 20.0 |
3 | Q9Y6F1_P34 | Q9Y6F1 | n/a | IC50(nM) = 1430.0 Kd(nM) = 700.0 |
4 | Q9H2K2_P34 | Q9H2K2 | n/a | IC50(nM) = 53.0 |
5 | P04977_P34 | P04977 | n/a | |
6 | Q5EK40_P34 | Q5EK40 | n/a | |
7 | C9Z6T8_P34 | C9Z6T8 | n/a | |
8 | Q4MV79_P34 | Q4MV79 | n/a | |
9 | O95271_P34 | O95271 | n/a | IC50(nM) = 39.0 |
10 | A0A222DLT0_P34 | A0A222DLT0 | n/a | |
11 | Q6SA23_P34 | Q6SA23 | n/a | |
12 | Q460N3_P34 | Q460N3 | n/a | IC50(nM) = 8913.0 |
13 | P13639_P34 | P13639 | n/a |