PDB ligand accession: PCG
DrugBank: DB02315
PubChem: 24316;5280386;135398570;
ChEMBL:
InChI Key: ZOOGRGPOEVQQDX-UUOKFMHZSA-N
SMILES: c1nc2c(n1C3C(C4C(O3)COP(=O)(O4)O)O)N=C(NC2=O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Cyclic purine nucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q6MLN6_PCG | Q6MLN6 | Signal transduction protein | n/a | |
2 | P29973_PCG | P29973 | Cyclic nucleotide-gated channel | n/a | |
3 | Q14028_PCG | Q14028 | Cyclic nucleotide-gated channel | n/a | |
4 | Q9NQW8_PCG | Q9NQW8 | Cyclic nucleotide-gated channel | n/a | |
5 | O88703_PCG | O88703 | Potassium/sodium hyperpolarization-activated cyclic | n/a | |
6 | C3SQJ7_PCG | C3SQJ7 | Catabolite activator protein | n/a | |
7 | P39779_PCG | P39779 | Global transcriptional regulator | n/a | |
8 | P10644_PCG | P10644 | cAMP-dependent protein kinase | n/a | |
9 | O76083_PCG | O76083 | High affinity cGMP-specific | n/a | |
10 | Q9Y3Q4_PCG | Q9Y3Q4 | Potassium/sodium hyperpolarization-activated cyclic | n/a | |
11 | P00514_PCG | P00514 | cAMP-dependent protein kinase | n/a | |
12 | Q16281_PCG | Q16281 | Cyclic nucleotide-gated channel | n/a | |
13 | G0GA88_PCG | G0GA88 | Transcriptional regulator, Crp/Fnr | n/a | |
14 | B0RM05_PCG | B0RM05 | diguanylate cyclase (EC | n/a | |
15 | E0RR11_PCG | E0RR11 | Cyclic nucleotide-binding domain-containing | n/a | |
16 | Q6P5T7_PCG | Q6P5T7 | cGMP-dependent protein kinase | n/a | |
17 | Q922S4_PCG | Q922S4 | cGMP-dependent 3',5'-cyclic phosphodiesterase | n/a | |
18 | P52175_PCG | P52175 | Nucleoside diphosphate kinase | n/a | |
19 | Q8MMZ4_PCG | Q8MMZ4 | cGMP-dependent protein kinase | n/a | |
20 | Q92SD2_PCG | Q92SD2 | cAMP-binding protein-catabolite gene | n/a | |
21 | Q98GN8_PCG | Q98GN8 | Cyclic nucleotide-gated potassium | n/a | |
22 | Q03611_PCG | Q03611 | Cyclic nucleotide-gated channel | n/a | |
23 | Q13237_PCG | Q13237 | cGMP-dependent protein kinase | n/a | |
24 | Q13976_PCG | Q13976 | cGMP-dependent protein kinase | n/a |