PDB ligand accession: PLS
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: ODVKKQWXKRZJLG-VIFPVBQESA-N
SMILES: Cc1c(c(c(cn1)COP(=O)(O)O)CNC(CO)C(=O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Pyridoxamines
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P0A2K1_PLS | P0A2K1 | Tryptophan synthase beta | n/a | |
2 | I7H6W6_PLS | I7H6W6 | Serine hydroxymethyltransferase (SHMT) | n/a | |
3 | O23254_PLS | O23254 | Serine hydroxymethyltransferase 4 | n/a | |
4 | A6BMJ3_PLS | A6BMJ3 | cysteine-S-conjugate beta-lyase (EC | n/a | |
5 | Q93UV0_PLS | Q93UV0 | Serine palmitoyltransferase (SPT) | n/a | |
6 | G7ILW0_PLS | G7ILW0 | Serine hydroxymethyltransferase (EC | n/a | |
7 | A7BFV6_PLS | A7BFV6 | Serine palmitoyltransferase (SPT) | n/a | |
8 | P9WP51_PLS | P9WP51 | Probable cystathionine beta-synthase | n/a | |
9 | Q8U093_PLS | Q8U093 | Tryptophan synthase beta | n/a | |
10 | A0A133CK16_PLS | A0A133CK16 | Serine hydroxymethyltransferase (SHMT) | n/a | |
11 | O15269_PLS | O15269 | Serine palmitoyltransferase 1 | n/a | |
12 | Q94C74_PLS | Q94C74 | Serine hydroxymethyltransferase 2, | n/a |