PDB ligand accession: PLT
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: MFRRQHVPLFTBMS-NUYDQDRBSA-N
SMILES: Cc1c(c(c(cn1)COP(=O)(O)O)C=NC(Cc2c[nH]c3c2cccc3)C(=O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Indoles and derivatives
- Subclass: Indolyl carboxylic acids and derivatives
- Class: Indoles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P0A2K1_PLT | P0A2K1 | Tryptophan synthase beta | n/a | |
2 | Q8U093_PLT | Q8U093 | Tryptophan synthase beta | n/a |