PDB ligand accession: PMM
DrugBank: DB03592
PubChem: 445462;5289180;135451578;
ChEMBL:
InChI Key: AJXFJEHKGGCFNM-UHFFFAOYSA-N
SMILES: c1c(nc2c(n1)N=C(NC2=O)N)COP(=O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P59655_PMM | P59655 | Dihydropteroate synthase (DHPS) | n/a | |
| 2 | P53848_PMM | P53848 | Folic acid synthesis | n/a | |
| 3 | S5PWL8_PMM | S5PWL8 | deleted | n/a | |
| 4 | P0A578_PMM | P0A578 | Dihydropteroate synthase (DHPS) | n/a | |
| 5 | Q81VW8_PMM | Q81VW8 | Dihydropteroate synthase (DHPS) | n/a | |
| 6 | A0A2U9PYL8_PMM | A0A2U9PYL8 | Dihydropteroate synthase (DHPS) | n/a |