PDB ligand accession: PNS
DrugBank: DB03912
PubChem:
ChEMBL: n/a
InChI Key: JDMUPRLRUUMCTL-VIFPVBQESA-N
SMILES: CC(C)(COP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0R0B3_PNS | A0R0B3 | Meromycolate extension acyl | n/a | |
2 | P23875_PNS | P23875 | Phosphopantetheine adenylyltransferase (EC | n/a | |
3 | Q88Z44_PNS | Q88Z44 | Holo-[acyl-carrier-protein] synthase (Holo-ACP | n/a | |
4 | B7H2D0_PNS | B7H2D0 | deleted | n/a | |
5 | Q88VM8_PNS | Q88VM8 | D-alanyl carrier protein | n/a | |
6 | F2K077_PNS | F2K077 | Butyryl-CoA dehydrogenase (EC | n/a | |
7 | P0C062_PNS | P0C062 | Gramicidin S synthase | n/a | |
8 | P0A530_PNS | P0A530 | Phosphopantetheine adenylyltransferase (EC | n/a | |
9 | P34731_PNS | P34731 | Fatty acid synthase | n/a | |
10 | Q03132_PNS | Q03132 | Erythronolide synthase EryA2 | n/a | |
11 | E9JES6_PNS | E9JES6 | CcbZ (Putative dehydrogenase/acyl | n/a | |
12 | B7MJ81_PNS | B7MJ81 | Acyl carrier protein | n/a | |
13 | A4PHM4_PNS | A4PHM4 | Hybrid non ribosomal | n/a | |
14 | Q76KY5_PNS | Q76KY5 | [acyl-carrier-protein] S-malonyltransferase (EC | n/a | |
15 | Q4KCZ1_PNS | Q4KCZ1 | Peptidyl carrier protein | n/a | |
16 | Q6DNF2_PNS | Q6DNF2 | CurA | n/a | |
17 | Q02054_PNS | Q02054 | Actinorhodin polyketide synthase | n/a | |
18 | P10378_PNS | P10378 | Enterobactin synthase component | n/a | |
19 | Q47NR9_PNS | Q47NR9 | Non-ribosomal peptide synthase:Amino | n/a | |
20 | Q5W265_PNS | Q5W265 | Probable acyl carrier | n/a | |
21 | L0R8F8_PNS | L0R8F8 | Mitochondrial ribosome and | n/a | |
22 | O77077_PNS | O77077 | Acyl carrier protein | n/a | |
23 | P0A6A8_PNS | P0A6A8 | Acyl carrier protein | n/a | |
24 | P43098_PNS | P43098 | Fatty acid synthase | n/a | |
25 | A0A140KF01_PNS | A0A140KF01 | Fatty acid synthase | n/a | |
26 | Q5EDC8_PNS | Q5EDC8 | Acyl carrier protein | n/a | |
27 | Q12053_PNS | Q12053 | Norsolorinic acid synthase | n/a | |
28 | P24224_PNS | P24224 | Holo-[acyl-carrier-protein] synthase (Holo-ACP | n/a | |
29 | P07854_PNS | P07854 | Acyl carrier protein | n/a | |
30 | O14561_PNS | O14561 | Acyl carrier protein, | n/a | |
31 | Q39T60_PNS | Q39T60 | Acyl carrier protein | n/a | |
32 | F1CWE4_PNS | F1CWE4 | TqaA | n/a | |
33 | P07149_PNS | P07149 | Fatty acid synthase | n/a | |
34 | F2K074_PNS | F2K074 | Alpha/beta hydrolase fold | n/a | |
35 | Q76KY4_PNS | Q76KY4 | Acyl-carrier-protein | n/a | |
36 | Q70LM7_PNS | Q70LM7 | Linear gramicidin synthase | n/a | |
37 | Q5G940_PNS | Q5G940 | 3-hydroxyacyl-[acyl-carrier-protein] dehydratase FabZ | n/a | |
38 | A4PHN0_PNS | A4PHN0 | Hybrid polyketide synthase-non | n/a | |
39 | I7FMV0_PNS | I7FMV0 | Polyketide synthase PKS13 | n/a | |
40 | A4PHM7_PNS | A4PHM7 | Enoyl-CoA hydratase | n/a | |
41 | W5NQT7_PNS | W5NQT7 | Acyl carrier protein | n/a | |
42 | Q82SY3_PNS | Q82SY3 | Carrier domain-containing protein | n/a | |
43 | P19097_PNS | P19097 | Fatty acid synthase | n/a | |
44 | H1ZZT7_PNS | H1ZZT7 | Type I modular | n/a | |
45 | A9CHM9_PNS | A9CHM9 | Aminoacyl carrier protein | n/a | |
46 | P28037_PNS | P28037 | Cytosolic 10-formyltetrahydrofolate dehydrogenase | n/a | |
47 | Q89VT8_PNS | Q89VT8 | Amino acid--[acyl-carrier-protein] ligase | n/a | |
48 | E5XP76_PNS | E5XP76 | Carboxylic acid reductase | n/a | |
49 | A0A806GVW0_PNS | A0A806GVW0 | deleted | n/a | |
50 | A0A6D2XA84_PNS | A0A6D2XA84 | deleted | n/a | |
51 | W5PGA3_PNS | W5PGA3 | deleted | n/a | |
52 | Q9WZK0_PNS | Q9WZK0 | Phosphopantetheine adenylyltransferase (EC | n/a | |
53 | G7RM21_PNS | G7RM21 | deleted | n/a | |
54 | Q89VT6_PNS | Q89VT6 | Aminoacyl carrier protein | n/a | |
55 | A0A5H1ZR44_PNS | A0A5H1ZR44 | holo-ObiF1 | n/a | |
56 | E9AD06_PNS | E9AD06 | Acyl carrier protein | n/a | |
57 | P39579_PNS | P39579 | D-alanyl carrier protein | n/a | |
58 | P21645_PNS | P21645 | UDP-3-O-(3-hydroxymyristoyl)glucosamine N-acyltransferase (UDP-3-O-(3-OHC14)-GlcN | n/a | |
59 | F4Y432_PNS | F4Y432 | CurD (Hydroxymethylglutaryl-CoA synthase | n/a | |
60 | Q5SJS9_PNS | Q5SJS9 | Phosphopantetheine adenylyltransferase (EC | n/a | |
61 | Q6DNF1_PNS | Q6DNF1 | CurB | n/a | |
62 | Q6N882_PNS | Q6N882 | Acyl carrier protein | n/a | |
63 | B1MDL6_PNS | B1MDL6 | Phosphopantetheine adenylyltransferase (EC | n/a |